C14H18F3N3O3S — CID 133355915
2-[1-[4-sulfamoyl-2-(trifluoromethyl)phenyl]piperidin-3-yl]acetamide (PubChem CID 133355915) has the molecular formula C14H18F3N3O3S and a molecular weight of 365.38 g/mol. Its IUPAC name is 2-[1-[4-sulfamoyl-2-(trifluoromethyl)phenyl]piperidin-3-yl]acetamide.
| Compound Name | 2-[1-[4-sulfamoyl-2-(trifluoromethyl)phenyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 133355915 |
| Molecular Formula | C14H18F3N3O3S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-[1-[4-sulfamoyl-2-(trifluoromethyl)phenyl]piperidin-3-yl]acetamide |
| SMILES | NC(=O)CC1CCCN(c2ccc(S(N)(=O)=O)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H18F3N3O3S/c15-14(16,17)11-7-10(24(19,22)23)3-4-12(11)20-5-1-2-9(8-20)6-13(18)21/h3-4,7,9H,1-2,5-6,8H2,(H2,18,21)(H2,19,22,23) |
| InChIKey | DEPNBWZJQKWYQM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |