C18H16ClFN4 — CID 133356492
N-[1-(2-chloro-6-fluorophenyl)ethyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine (PubChem CID 133356492) has the molecular formula C18H16ClFN4 and a molecular weight of 342.81 g/mol. Its IUPAC name is N-[1-(2-chloro-6-fluorophenyl)ethyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | N-[1-(2-chloro-6-fluorophenyl)ethyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133356492 |
| Molecular Formula | C18H16ClFN4 |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[1-(2-chloro-6-fluorophenyl)ethyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine |
| SMILES | Cc1cc(NC(C)c2c(F)cccc2Cl)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C18H16ClFN4/c1-11-9-16(24-18(22-11)13-5-4-8-21-10-13)23-12(2)17-14(19)6-3-7-15(17)20/h3-10,12H,1-2H3,(H,22,23,24) |
| InChIKey | WSNGWEHFOLGNQK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |