C15H14F3N3O — CID 133357479
4-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)amino]-3-(trifluoromethyl)benzonitrile (PubChem CID 133357479) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is 4-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)amino]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)amino]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133357479 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)amino]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(NC2CC(=O)N(C3CC3)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F3N3O/c16-15(17,18)12-5-9(7-19)1-4-13(12)20-10-6-14(22)21(8-10)11-2-3-11/h1,4-5,10-11,20H,2-3,6,8H2 |
| InChIKey | BDQTXZWIIJGBNY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |