C16H18ClN5O — CID 133358244
6-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]pyrazine-2-carboxamide (PubChem CID 133358244) has the molecular formula C16H18ClN5O and a molecular weight of 331.81 g/mol. Its IUPAC name is 6-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]pyrazine-2-carboxamide.
| Compound Name | 6-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133358244 |
| Molecular Formula | C16H18ClN5O |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 6-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cncc(N2CCN(Cc3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C16H18ClN5O/c17-13-3-1-2-12(8-13)11-21-4-6-22(7-5-21)15-10-19-9-14(20-15)16(18)23/h1-3,8-10H,4-7,11H2,(H2,18,23) |
| InChIKey | WXKZVYOKIDOOMK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |