C15H17ClN6O — CID 56723039
6-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]pyrazine-2-carboxamide (PubChem CID 56723039) has the molecular formula C15H17ClN6O and a molecular weight of 332.80 g/mol. Its IUPAC name is 6-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]pyrazine-2-carboxamide.
| Compound Name | 6-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 56723039 |
| Molecular Formula | C15H17ClN6O |
| Molecular Weight | 332.80 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 6-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cncc(N2CCN(Cc3ccc(Cl)nc3)CC2)n1 |
| InChI | InChI=1S/C15H17ClN6O/c16-13-2-1-11(7-19-13)10-21-3-5-22(6-4-21)14-9-18-8-12(20-14)15(17)23/h1-2,7-9H,3-6,10H2,(H2,17,23) |
| InChIKey | MDFFJQVCWJTJBS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.80 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|