C17H17Cl2N3O — CID 26756608
[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-(6-chloro-3-pyridinyl)methanone (PubChem CID 26756608) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)methyl]piperazin-1-yl]-(6-chloro-3-pyridinyl)methanone.
| Compound Name | [4-[(4-chlorophenyl)methyl]piperazin-1-yl]-(6-chloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 26756608 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [4-[(4-chlorophenyl)methyl]piperazin-1-yl]-(6-chloro-3-pyridinyl)methanone |
| SMILES | O=C(c1ccc(Cl)nc1)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H17Cl2N3O/c18-15-4-1-13(2-5-15)12-21-7-9-22(10-8-21)17(23)14-3-6-16(19)20-11-14/h1-6,11H,7-10,12H2 |
| InChIKey | NRCOYPQAWISZNW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|