C19H27ClN4O2 — CID 51257092
2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3,5-dimethylpiperidin-1-yl)ethanone (PubChem CID 51257092) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3,5-dimethylpiperidin-1-yl)ethanone.
| Compound Name | 2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3,5-dimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 51257092 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3,5-dimethylpiperidin-1-yl)ethanone |
| SMILES | CC1CC(C)CN(C(=O)CN2CCN(C(=O)c3ccc(Cl)nc3)CC2)C1 |
| InChI | InChI=1S/C19H27ClN4O2/c1-14-9-15(2)12-24(11-14)18(25)13-22-5-7-23(8-6-22)19(26)16-3-4-17(20)21-10-16/h3-4,10,14-15H,5-9,11-13H2,1-2H3 |
| InChIKey | OHHQMPXJTLIXIA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|