C17H20N4O2S — CID 133359068
1-[2-[[(6-cyano-3-pyridinyl)amino]methyl]phenyl]-N-propan-2-ylmethanesulfonamide (PubChem CID 133359068) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-[2-[[(6-cyano-3-pyridinyl)amino]methyl]phenyl]-N-propan-2-ylmethanesulfonamide.
| Compound Name | 1-[2-[[(6-cyano-3-pyridinyl)amino]methyl]phenyl]-N-propan-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 133359068 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[2-[[(6-cyano-3-pyridinyl)amino]methyl]phenyl]-N-propan-2-ylmethanesulfonamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccccc1CNc1ccc(C#N)nc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-13(2)21-24(22,23)12-15-6-4-3-5-14(15)10-19-17-8-7-16(9-18)20-11-17/h3-8,11,13,19,21H,10,12H2,1-2H3 |
| InChIKey | DDHBFTJEJOVGJL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |