C18H20F2N4O3S — CID 133359449
N-[1-[5-[(3,4-difluorophenyl)sulfamoyl]-2-pyridinyl]piperidin-4-yl]acetamide (PubChem CID 133359449) has the molecular formula C18H20F2N4O3S and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[1-[5-[(3,4-difluorophenyl)sulfamoyl]-2-pyridinyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[5-[(3,4-difluorophenyl)sulfamoyl]-2-pyridinyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 133359449 |
| Molecular Formula | C18H20F2N4O3S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-[1-[5-[(3,4-difluorophenyl)sulfamoyl]-2-pyridinyl]piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(c2ccc(S(=O)(=O)Nc3ccc(F)c(F)c3)cn2)CC1 |
| InChI | InChI=1S/C18H20F2N4O3S/c1-12(25)22-13-6-8-24(9-7-13)18-5-3-15(11-21-18)28(26,27)23-14-2-4-16(19)17(20)10-14/h2-5,10-11,13,23H,6-9H2,1H3,(H,22,25) |
| InChIKey | DPQOKVBQPHSNNP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |