C19H20F2N4O2S — CID 133453619
6-(4-but-3-ynylpiperazin-1-yl)-N-(3,4-difluorophenyl)pyridine-3-sulfonamide (PubChem CID 133453619) has the molecular formula C19H20F2N4O2S and a molecular weight of 406.46 g/mol. Its IUPAC name is 6-(4-but-3-ynylpiperazin-1-yl)-N-(3,4-difluorophenyl)pyridine-3-sulfonamide.
| Compound Name | 6-(4-but-3-ynylpiperazin-1-yl)-N-(3,4-difluorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133453619 |
| Molecular Formula | C19H20F2N4O2S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 6-(4-but-3-ynylpiperazin-1-yl)-N-(3,4-difluorophenyl)pyridine-3-sulfonamide |
| SMILES | C#CCCN1CCN(c2ccc(S(=O)(=O)Nc3ccc(F)c(F)c3)cn2)CC1 |
| InChI | InChI=1S/C19H20F2N4O2S/c1-2-3-8-24-9-11-25(12-10-24)19-7-5-16(14-22-19)28(26,27)23-15-4-6-17(20)18(21)13-15/h1,4-7,13-14,23H,3,8-12H2 |
| InChIKey | MOIRZWUAGSBHPZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|