C17H27N3O3S — CID 133360362
N-[[1-(6-tert-butylsulfonyl-3-pyridinyl)piperidin-3-yl]methyl]acetamide (PubChem CID 133360362) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is N-[[1-(6-tert-butylsulfonyl-3-pyridinyl)piperidin-3-yl]methyl]acetamide.
| Compound Name | N-[[1-(6-tert-butylsulfonyl-3-pyridinyl)piperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 133360362 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-[[1-(6-tert-butylsulfonyl-3-pyridinyl)piperidin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCCN(c2ccc(S(=O)(=O)C(C)(C)C)nc2)C1 |
| InChI | InChI=1S/C17H27N3O3S/c1-13(21)18-10-14-6-5-9-20(12-14)15-7-8-16(19-11-15)24(22,23)17(2,3)4/h7-8,11,14H,5-6,9-10,12H2,1-4H3,(H,18,21) |
| InChIKey | OTOGBFVVJNNIOO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |