C18H30N2O3S — CID 133359969
2-tert-butylsulfonyl-5-[4-(2-methylpropoxy)piperidin-1-yl]pyridine (PubChem CID 133359969) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is 2-tert-butylsulfonyl-5-[4-(2-methylpropoxy)piperidin-1-yl]pyridine.
| Compound Name | 2-tert-butylsulfonyl-5-[4-(2-methylpropoxy)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 133359969 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2-tert-butylsulfonyl-5-[4-(2-methylpropoxy)piperidin-1-yl]pyridine |
| SMILES | CC(C)COC1CCN(c2ccc(S(=O)(=O)C(C)(C)C)nc2)CC1 |
| InChI | InChI=1S/C18H30N2O3S/c1-14(2)13-23-16-8-10-20(11-9-16)15-6-7-17(19-12-15)24(21,22)18(3,4)5/h6-7,12,14,16H,8-11,13H2,1-5H3 |
| InChIKey | PIJFTYWUZJAUMK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |