C16H26N2O2S2 — CID 102560377
1-(6-tert-butylsulfonyl-3-pyridinyl)-3-methylsulfanylazepane (PubChem CID 102560377) has the molecular formula C16H26N2O2S2 and a molecular weight of 342.53 g/mol. Its IUPAC name is 1-(6-tert-butylsulfonyl-3-pyridinyl)-3-methylsulfanylazepane.
| Compound Name | 1-(6-tert-butylsulfonyl-3-pyridinyl)-3-methylsulfanylazepane |
|---|---|
| PubChem CID | 102560377 |
| Molecular Formula | C16H26N2O2S2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-(6-tert-butylsulfonyl-3-pyridinyl)-3-methylsulfanylazepane |
| SMILES | CSC1CCCCN(c2ccc(S(=O)(=O)C(C)(C)C)nc2)C1 |
| InChI | InChI=1S/C16H26N2O2S2/c1-16(2,3)22(19,20)15-9-8-13(11-17-15)18-10-6-5-7-14(12-18)21-4/h8-9,11,14H,5-7,10,12H2,1-4H3 |
| InChIKey | GXSFGQMLMJKQKD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |