C18H24ClN5O4S — CID 133361893
4-[2-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]pyrrolidin-1-yl]-3-nitrobenzenesulfonamide (PubChem CID 133361893) has the molecular formula C18H24ClN5O4S and a molecular weight of 441.94 g/mol. Its IUPAC name is 4-[2-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]pyrrolidin-1-yl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]pyrrolidin-1-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133361893 |
| Molecular Formula | C18H24ClN5O4S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 4-[2-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]pyrrolidin-1-yl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1C1CCCN1c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24ClN5O4S/c1-11(2)10-23-18(19)17(12(3)21-23)15-5-4-8-22(15)14-7-6-13(29(20,27)28)9-16(14)24(25)26/h6-7,9,11,15H,4-5,8,10H2,1-3H3,(H2,20,27,28) |
| InChIKey | OWVNGYLQTKPDCU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|