C19H20FN3O3 — CID 133362943
4-benzyl-6-(3-fluoro-2-nitrophenyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 133362943) has the molecular formula C19H20FN3O3 and a molecular weight of 357.38 g/mol. Its IUPAC name is 4-benzyl-6-(3-fluoro-2-nitrophenyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | 4-benzyl-6-(3-fluoro-2-nitrophenyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 133362943 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-benzyl-6-(3-fluoro-2-nitrophenyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | O=[N+]([O-])c1c(F)cccc1N1CC2OCCN(Cc3ccccc3)C2C1 |
| InChI | InChI=1S/C19H20FN3O3/c20-15-7-4-8-16(19(15)23(24)25)22-12-17-18(13-22)26-10-9-21(17)11-14-5-2-1-3-6-14/h1-8,17-18H,9-13H2 |
| InChIKey | CETHYDPFUUFHHS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|