C18H15F3N4OS — CID 133363739
4-[2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-yl]-2-thiophen-2-ylmorpholine (PubChem CID 133363739) has the molecular formula C18H15F3N4OS and a molecular weight of 392.41 g/mol. Its IUPAC name is 4-[2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-yl]-2-thiophen-2-ylmorpholine.
| Compound Name | 4-[2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-yl]-2-thiophen-2-ylmorpholine |
|---|---|
| PubChem CID | 133363739 |
| Molecular Formula | C18H15F3N4OS |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-[2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-yl]-2-thiophen-2-ylmorpholine |
| SMILES | FC(F)(F)c1cc(N2CCOC(c3cccs3)C2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C18H15F3N4OS/c19-18(20,21)15-9-16(24-17(23-15)12-3-1-5-22-10-12)25-6-7-26-13(11-25)14-4-2-8-27-14/h1-5,8-10,13H,6-7,11H2 |
| InChIKey | YIQGDIRFAXGJAZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |