C21H21N3O — CID 13336375
azepan-1-yl-(2-phenylquinazolin-4-yl)methanone (PubChem CID 13336375) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is azepan-1-yl-(2-phenylquinazolin-4-yl)methanone.
| Compound Name | azepan-1-yl-(2-phenylquinazolin-4-yl)methanone |
|---|---|
| PubChem CID | 13336375 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | azepan-1-yl-(2-phenylquinazolin-4-yl)methanone |
| SMILES | O=C(c1nc(-c2ccccc2)nc2ccccc12)N1CCCCCC1 |
| InChI | InChI=1S/C21H21N3O/c25-21(24-14-8-1-2-9-15-24)19-17-12-6-7-13-18(17)22-20(23-19)16-10-4-3-5-11-16/h3-7,10-13H,1-2,8-9,14-15H2 |
| InChIKey | YBIQOPFCPPGNRF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |