About (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone
(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone (PubChem CID 90410954) has the molecular formula C24H17F2N3O
and a molecular weight of 401.42 g/mol. Its IUPAC name is (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone.
Molecular Properties
| Compound Name | (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone |
| PubChem CID | 90410954 |
| Molecular Formula | C24H17F2N3O |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone |
| SMILES | O=C(c1nc(-c2ccc(F)cc2)nc2ccccc12)N1CCc2c(F)cccc2C1 |
| InChI | InChI=1S/C24H17F2N3O/c25-17-10-8-15(9-11-17)23-27-21-7-2-1-5-19(21)22(28-23)24(30)29-13-12-18-16(14-29)4-3-6-20(18)26/h1-11H,12-14H2 |
| InChIKey | LZAAQJRGEQLQOO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone?
The IUPAC name of (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone (CID 90410954) is (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone.
What is the SMILES notation for (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone?
The canonical SMILES for (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone is O=C(c1nc(-c2ccc(F)cc2)nc2ccccc12)N1CCc2c(F)cccc2C1.
What is the InChIKey of (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone?
The InChIKey is LZAAQJRGEQLQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F2N3O/c25-17-10-8-15(9-11-17)23-27-21-7-2-1-5-19(21)22(28-23)24(30)29-13-12-18-16(14-29)4-3-6-20(18)26/h1-11H,12-14H2.
What are the key properties of (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone?
(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone has a molecular weight of 401.42 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(4-fluorophenyl)quinazolin-4-yl]methanone is sourced from PubChem (CID 90410954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).