C22H25N5OS — CID 133364518
4-methyl-6-(2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 133364518) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-methyl-6-(2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | 4-methyl-6-(2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 133364518 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-methyl-6-(2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CN1CCOC2CN(c3nc(-c4cccnc4)nc4sc5c(c34)CCCC5)CC21 |
| InChI | InChI=1S/C22H25N5OS/c1-26-9-10-28-17-13-27(12-16(17)26)21-19-15-6-2-3-7-18(15)29-22(19)25-20(24-21)14-5-4-8-23-11-14/h4-5,8,11,16-17H,2-3,6-7,9-10,12-13H2,1H3 |
| InChIKey | WIDIEGFCNZTWRM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |