C16H18N6O — CID 133366006
4-N-[2-(4-methoxyphenyl)ethyl]-6-pyrazol-1-ylpyrimidine-4,5-diamine (PubChem CID 133366006) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-N-[2-(4-methoxyphenyl)ethyl]-6-pyrazol-1-ylpyrimidine-4,5-diamine.
| Compound Name | 4-N-[2-(4-methoxyphenyl)ethyl]-6-pyrazol-1-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 133366006 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-N-[2-(4-methoxyphenyl)ethyl]-6-pyrazol-1-ylpyrimidine-4,5-diamine |
| SMILES | COc1ccc(CCNc2ncnc(-n3cccn3)c2N)cc1 |
| InChI | InChI=1S/C16H18N6O/c1-23-13-5-3-12(4-6-13)7-9-18-15-14(17)16(20-11-19-15)22-10-2-8-21-22/h2-6,8,10-11H,7,9,17H2,1H3,(H,18,19,20) |
| InChIKey | IGMWLMOWBRZXRF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |