C16H17N5O2 — CID 133367384
N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-4-methyl-3-nitropyridin-2-amine (PubChem CID 133367384) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-4-methyl-3-nitropyridin-2-amine.
| Compound Name | N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-4-methyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133367384 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-4-methyl-3-nitropyridin-2-amine |
| SMILES | Cc1ccnc(NCc2nc3cccc(C)c3n2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N5O2/c1-10-5-4-6-12-14(10)20(3)13(19-12)9-18-16-15(21(22)23)11(2)7-8-17-16/h4-8H,9H2,1-3H3,(H,17,18) |
| InChIKey | BHXBRAWVTNELPP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|