C16H15N5O4 — CID 133367353
N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-2,4-dinitroaniline (PubChem CID 133367353) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-2,4-dinitroaniline.
| Compound Name | N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 133367353 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-2,4-dinitroaniline |
| SMILES | Cc1cccc2nc(CNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])n(C)c12 |
| InChI | InChI=1S/C16H15N5O4/c1-10-4-3-5-13-16(10)19(2)15(18-13)9-17-12-7-6-11(20(22)23)8-14(12)21(24)25/h3-8,17H,9H2,1-2H3 |
| InChIKey | OOSWGHZGEMOESL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|