C17H18BrN5O — CID 133367412
5-[[(6-bromoquinazolin-4-yl)amino]methyl]-3,4-diethyl-1H-pyridazin-6-one (PubChem CID 133367412) has the molecular formula C17H18BrN5O and a molecular weight of 388.27 g/mol. Its IUPAC name is 5-[[(6-bromoquinazolin-4-yl)amino]methyl]-3,4-diethyl-1H-pyridazin-6-one.
| Compound Name | 5-[[(6-bromoquinazolin-4-yl)amino]methyl]-3,4-diethyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 133367412 |
| Molecular Formula | C17H18BrN5O |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 5-[[(6-bromoquinazolin-4-yl)amino]methyl]-3,4-diethyl-1H-pyridazin-6-one |
| SMILES | CCc1n[nH]c(=O)c(CNc2ncnc3ccc(Br)cc23)c1CC |
| InChI | InChI=1S/C17H18BrN5O/c1-3-11-13(17(24)23-22-14(11)4-2)8-19-16-12-7-10(18)5-6-15(12)20-9-21-16/h5-7,9H,3-4,8H2,1-2H3,(H,23,24)(H,19,20,21) |
| InChIKey | AHJCYGIPKJRORS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |