C17H17F3N6O — CID 133367897
N-[2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethyl]benzamide (PubChem CID 133367897) has the molecular formula C17H17F3N6O and a molecular weight of 378.36 g/mol. Its IUPAC name is N-[2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 133367897 |
| Molecular Formula | C17H17F3N6O |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethyl]benzamide |
| SMILES | Cc1c(NCCNC(=O)c2ccccc2)nn2c(C(F)(F)F)nnc2c1C |
| InChI | InChI=1S/C17H17F3N6O/c1-10-11(2)14-23-24-16(17(18,19)20)26(14)25-13(10)21-8-9-22-15(27)12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3,(H,21,25)(H,22,27) |
| InChIKey | QMWNGLGVAHDMIP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|