C15H21F3N6O — CID 133388279
N-[2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 133388279) has the molecular formula C15H21F3N6O and a molecular weight of 358.37 g/mol. Its IUPAC name is N-[2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 133388279 |
| Molecular Formula | C15H21F3N6O |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | Cc1c(NCCNC(=O)C(C)(C)C)nn2c(C(F)(F)F)nnc2c1C |
| InChI | InChI=1S/C15H21F3N6O/c1-8-9(2)11-21-22-12(15(16,17)18)24(11)23-10(8)19-6-7-20-13(25)14(3,4)5/h6-7H2,1-5H3,(H,19,23)(H,20,25) |
| InChIKey | QZTSJSUTYFACLP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|