C12H14F3N5O2 — CID 122058687
4-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]butanoic acid (PubChem CID 122058687) has the molecular formula C12H14F3N5O2 and a molecular weight of 317.27 g/mol. Its IUPAC name is 4-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]butanoic acid.
| Compound Name | 4-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 122058687 |
| Molecular Formula | C12H14F3N5O2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]butanoic acid |
| SMILES | Cc1c(NCCCC(=O)O)nn2c(C(F)(F)F)nnc2c1C |
| InChI | InChI=1S/C12H14F3N5O2/c1-6-7(2)10-17-18-11(12(13,14)15)20(10)19-9(6)16-5-3-4-8(21)22/h3-5H2,1-2H3,(H,16,19)(H,21,22) |
| InChIKey | GONYESCQMJIPBV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|