C14H15N5O2 — CID 122058463
4-[(3-methyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)amino]butanoic acid (PubChem CID 122058463) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 4-[(3-methyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)amino]butanoic acid.
| Compound Name | 4-[(3-methyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 122058463 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-[(3-methyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)amino]butanoic acid |
| SMILES | Cc1nnc2c3ccccc3c(NCCCC(=O)O)nn12 |
| InChI | InChI=1S/C14H15N5O2/c1-9-16-17-14-11-6-3-2-5-10(11)13(18-19(9)14)15-8-4-7-12(20)21/h2-3,5-6H,4,7-8H2,1H3,(H,15,18)(H,20,21) |
| InChIKey | HXASDYUFBJLXBC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|