C14H14N4O2 — CID 82167258
4-(6-methyl-[1,2,4]triazolo[3,4-a]phthalazin-3-yl)butanoic acid (PubChem CID 82167258) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-(6-methyl-[1,2,4]triazolo[3,4-a]phthalazin-3-yl)butanoic acid.
| Compound Name | 4-(6-methyl-[1,2,4]triazolo[3,4-a]phthalazin-3-yl)butanoic acid |
|---|---|
| PubChem CID | 82167258 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 4-(6-methyl-[1,2,4]triazolo[3,4-a]phthalazin-3-yl)butanoic acid |
| SMILES | Cc1nn2c(CCCC(=O)O)nnc2c2ccccc12 |
| InChI | InChI=1S/C14H14N4O2/c1-9-10-5-2-3-6-11(10)14-16-15-12(18(14)17-9)7-4-8-13(19)20/h2-3,5-6H,4,7-8H2,1H3,(H,19,20) |
| InChIKey | ZYAIUQKZOUYFEY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |