C10H8N4O — CID 13185782
6-methyl-2H-[1,2,4]triazolo[3,4-a]phthalazin-3-one (PubChem CID 13185782) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 6-methyl-2H-[1,2,4]triazolo[3,4-a]phthalazin-3-one.
| Compound Name | 6-methyl-2H-[1,2,4]triazolo[3,4-a]phthalazin-3-one |
|---|---|
| PubChem CID | 13185782 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 6-methyl-2H-[1,2,4]triazolo[3,4-a]phthalazin-3-one |
| SMILES | Cc1nn2c(=O)[nH]nc2c2ccccc12 |
| InChI | InChI=1S/C10H8N4O/c1-6-7-4-2-3-5-8(7)9-11-12-10(15)14(9)13-6/h2-5H,1H3,(H,12,15) |
| InChIKey | NHQUYNOYSXFTIM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |