C11H8N6O — CID 10823939
8-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11-hexaen-14-one (PubChem CID 10823939) has the molecular formula C11H8N6O and a molecular weight of 240.23 g/mol. Its IUPAC name is 8-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11-hexaen-14-one.
| Compound Name | 8-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11-hexaen-14-one |
|---|---|
| PubChem CID | 10823939 |
| Molecular Formula | C11H8N6O |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 8-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11-hexaen-14-one |
| SMILES | Cn1c2ccccc2c2nn3c(=O)[nH]nc3nc21 |
| InChI | InChI=1S/C11H8N6O/c1-16-7-5-3-2-4-6(7)8-9(16)12-10-13-14-11(18)17(10)15-8/h2-5H,1H3,(H,14,18) |
| InChIKey | MZGYRKLXOPUTFX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |