C18H14N6 — CID 117058463
8-methyl-14-(4-methylphenyl)-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaene (PubChem CID 117058463) has the molecular formula C18H14N6 and a molecular weight of 314.35 g/mol. Its IUPAC name is 8-methyl-14-(4-methylphenyl)-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaene.
| Compound Name | 8-methyl-14-(4-methylphenyl)-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaene |
|---|---|
| PubChem CID | 117058463 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 8-methyl-14-(4-methylphenyl)-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaene |
| SMILES | Cc1ccc(-c2nnc3nc4c(nn23)c2ccccc2n4C)cc1 |
| InChI | InChI=1S/C18H14N6/c1-11-7-9-12(10-8-11)16-20-21-18-19-17-15(22-24(16)18)13-5-3-4-6-14(13)23(17)2/h3-10H,1-2H3 |
| InChIKey | XCURNKKASSZWIK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |