C18H15N7 — CID 135603427
4-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-yl)-N,N-dimethylaniline (PubChem CID 135603427) has the molecular formula C18H15N7 and a molecular weight of 329.37 g/mol. Its IUPAC name is 4-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-yl)-N,N-dimethylaniline.
| Compound Name | 4-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 135603427 |
| Molecular Formula | C18H15N7 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nnc3nc4[nH]c5ccccc5c4nn23)cc1 |
| InChI | InChI=1S/C18H15N7/c1-24(2)12-9-7-11(8-10-12)17-21-22-18-20-16-15(23-25(17)18)13-5-3-4-6-14(13)19-16/h3-10H,1-2H3,(H,19,20,22) |
| InChIKey | DMOIXQKWBMWSJI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |