C13H10N6O2S — CID 135603421
3-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ylsulfanyl)propanoic acid (PubChem CID 135603421) has the molecular formula C13H10N6O2S and a molecular weight of 314.33 g/mol. Its IUPAC name is 3-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ylsulfanyl)propanoic acid.
| Compound Name | 3-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 135603421 |
| Molecular Formula | C13H10N6O2S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 3-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ylsulfanyl)propanoic acid |
| SMILES | O=C(O)CCSc1nnc2nc3[nH]c4ccccc4c3nn12 |
| InChI | InChI=1S/C13H10N6O2S/c20-9(21)5-6-22-13-17-16-12-15-11-10(18-19(12)13)7-3-1-2-4-8(7)14-11/h1-4H,5-6H2,(H,20,21)(H,14,15,16) |
| InChIKey | VKQUMTIRHHAYEH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |