C13H9N6O2S- — CID 6974892
2-[(8-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-yl)sulfanyl]acetate (PubChem CID 6974892) has the molecular formula C13H9N6O2S- and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-[(8-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-yl)sulfanyl]acetate.
| Compound Name | 2-[(8-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 6974892 |
| Molecular Formula | C13H9N6O2S- |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-[(8-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-yl)sulfanyl]acetate |
| SMILES | Cn1c2ccccc2c2nn3c(SCC(=O)[O-])nnc3nc21 |
| InChI | InChI=1S/C13H10N6O2S/c1-18-8-5-3-2-4-7(8)10-11(18)14-12-15-16-13(19(12)17-10)22-6-9(20)21/h2-5H,6H2,1H3,(H,20,21)/p-1 |
| InChIKey | CZSLPRPHNNOBHT-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 101.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |