C19H16N6O2S — CID 23861416
4-[3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]benzamide (PubChem CID 23861416) has the molecular formula C19H16N6O2S and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-[3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]benzamide.
| Compound Name | 4-[3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 23861416 |
| Molecular Formula | C19H16N6O2S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-[3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CCSc2nnc3c(n2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C19H16N6O2S/c20-17(27)11-5-7-12(8-6-11)21-15(26)9-10-28-19-23-18-16(24-25-19)13-3-1-2-4-14(13)22-18/h1-8H,9-10H2,(H2,20,27)(H,21,26)(H,22,23,25) |
| InChIKey | RAOVRPPPJIGABL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |