C12H14N4 — CID 91259298
ethane;3-methyl-5H-[1,2,4]triazino[5,6-b]indole (PubChem CID 91259298) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is ethane;3-methyl-5H-[1,2,4]triazino[5,6-b]indole.
| Compound Name | ethane;3-methyl-5H-[1,2,4]triazino[5,6-b]indole |
|---|---|
| PubChem CID | 91259298 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethane;3-methyl-5H-[1,2,4]triazino[5,6-b]indole |
| SMILES | CC.Cc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C10H8N4.C2H6/c1-6-11-10-9(14-13-6)7-4-2-3-5-8(7)12-10;1-2/h2-5H,1H3,(H,11,12,13);1-2H3 |
| InChIKey | HPSHNJCXIZPUAT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |