C18H17N5 — CID 11392509
N-[2-(3-methylphenyl)ethyl]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 11392509) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[2-(3-methylphenyl)ethyl]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[2-(3-methylphenyl)ethyl]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 11392509 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[2-(3-methylphenyl)ethyl]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cc1cccc(CCNc2nnc3c(n2)[nH]c2ccccc23)c1 |
| InChI | InChI=1S/C18H17N5/c1-12-5-4-6-13(11-12)9-10-19-18-21-17-16(22-23-18)14-7-2-3-8-15(14)20-17/h2-8,11H,9-10H2,1H3,(H2,19,20,21,23) |
| InChIKey | QAHWETBRRCLVKF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |