C14H16BrN5O2S — CID 133368332
5-[4-(5-bromo-2-nitrophenyl)-1,4-diazepan-1-yl]-3-methyl-1,2,4-thiadiazole (PubChem CID 133368332) has the molecular formula C14H16BrN5O2S and a molecular weight of 398.29 g/mol. Its IUPAC name is 5-[4-(5-bromo-2-nitrophenyl)-1,4-diazepan-1-yl]-3-methyl-1,2,4-thiadiazole.
| Compound Name | 5-[4-(5-bromo-2-nitrophenyl)-1,4-diazepan-1-yl]-3-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133368332 |
| Molecular Formula | C14H16BrN5O2S |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 5-[4-(5-bromo-2-nitrophenyl)-1,4-diazepan-1-yl]-3-methyl-1,2,4-thiadiazole |
| SMILES | Cc1nsc(N2CCCN(c3cc(Br)ccc3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C14H16BrN5O2S/c1-10-16-14(23-17-10)19-6-2-5-18(7-8-19)13-9-11(15)3-4-12(13)20(21)22/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | RHUDIKLKUINSSB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|