C15H19N3O2S — CID 133369141
4-methoxy-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)pyrimidin-2-amine (PubChem CID 133369141) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-methoxy-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-methoxy-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 133369141 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-methoxy-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)pyrimidin-2-amine |
| SMILES | COc1ccnc(N(Cc2cccs2)CC2CCCO2)n1 |
| InChI | InChI=1S/C15H19N3O2S/c1-19-14-6-7-16-15(17-14)18(10-12-4-2-8-20-12)11-13-5-3-9-21-13/h3,5-7,9,12H,2,4,8,10-11H2,1H3 |
| InChIKey | ZNOXSWQQEXEQIK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |