C13H13ClF3N5O2S — CID 133369617
3-tert-butyl-5-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazol-4-amine (PubChem CID 133369617) has the molecular formula C13H13ClF3N5O2S and a molecular weight of 395.79 g/mol. Its IUPAC name is 3-tert-butyl-5-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazol-4-amine.
| Compound Name | 3-tert-butyl-5-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 133369617 |
| Molecular Formula | C13H13ClF3N5O2S |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 3-tert-butyl-5-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazol-4-amine |
| SMILES | CC(C)(C)c1nnc(Sc2cc(Cl)c(C(F)(F)F)cc2[N+](=O)[O-])n1N |
| InChI | InChI=1S/C13H13ClF3N5O2S/c1-12(2,3)10-19-20-11(21(10)18)25-9-5-7(14)6(13(15,16)17)4-8(9)22(23)24/h4-5H,18H2,1-3H3 |
| InChIKey | GYYOSLJFTFXOCY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|