C12H14FN5O2S — CID 133369661
3-tert-butyl-5-(4-fluoro-2-nitrophenyl)sulfanyl-1,2,4-triazol-4-amine (PubChem CID 133369661) has the molecular formula C12H14FN5O2S and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-tert-butyl-5-(4-fluoro-2-nitrophenyl)sulfanyl-1,2,4-triazol-4-amine.
| Compound Name | 3-tert-butyl-5-(4-fluoro-2-nitrophenyl)sulfanyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 133369661 |
| Molecular Formula | C12H14FN5O2S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-tert-butyl-5-(4-fluoro-2-nitrophenyl)sulfanyl-1,2,4-triazol-4-amine |
| SMILES | CC(C)(C)c1nnc(Sc2ccc(F)cc2[N+](=O)[O-])n1N |
| InChI | InChI=1S/C12H14FN5O2S/c1-12(2,3)10-15-16-11(17(10)14)21-9-5-4-7(13)6-8(9)18(19)20/h4-6H,14H2,1-3H3 |
| InChIKey | IQNFHRYXYGFISZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|