C15H10F4N4OS — CID 133370858
2,3,5,6-tetrafluoro-4-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]pyridine (PubChem CID 133370858) has the molecular formula C15H10F4N4OS and a molecular weight of 370.33 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]pyridine |
|---|---|
| PubChem CID | 133370858 |
| Molecular Formula | C15H10F4N4OS |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]pyridine |
| SMILES | COc1ccccc1-c1nnc(Sc2c(F)c(F)nc(F)c2F)n1C |
| InChI | InChI=1S/C15H10F4N4OS/c1-23-14(7-5-3-4-6-8(7)24-2)21-22-15(23)25-11-9(16)12(18)20-13(19)10(11)17/h3-6H,1-2H3 |
| InChIKey | MASAKULBHJNFPH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|