C13H7F4N5S — CID 133370833
2,3,5,6-tetrafluoro-4-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]pyridine (PubChem CID 133370833) has the molecular formula C13H7F4N5S and a molecular weight of 341.29 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]pyridine |
|---|---|
| PubChem CID | 133370833 |
| Molecular Formula | C13H7F4N5S |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]pyridine |
| SMILES | Cn1c(Sc2c(F)c(F)nc(F)c2F)nnc1-c1ccncc1 |
| InChI | InChI=1S/C13H7F4N5S/c1-22-12(6-2-4-18-5-3-6)20-21-13(22)23-9-7(14)10(16)19-11(17)8(9)15/h2-5H,1H3 |
| InChIKey | DCIZVWKNXFGAAA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|