C15H13F4N3O — CID 133371036
N-(2,6-dimethylphenyl)-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]acetamide (PubChem CID 133371036) has the molecular formula C15H13F4N3O and a molecular weight of 327.28 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 133371036 |
| Molecular Formula | C15H13F4N3O |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C15H13F4N3O/c1-7-4-3-5-8(2)12(7)21-9(23)6-20-13-10(16)14(18)22-15(19)11(13)17/h3-5H,6H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | DPBHGQFEFLAPCL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|