C20H20F3N3O — CID 133373169
2-[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]-5-(trifluoromethyl)benzonitrile (PubChem CID 133373169) has the molecular formula C20H20F3N3O and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133373169 |
| Molecular Formula | C20H20F3N3O |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]-5-(trifluoromethyl)benzonitrile |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)c1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C20H20F3N3O/c1-25(19-7-4-17(20(21,22)23)12-16(19)13-24)14-15-2-5-18(6-3-15)26-8-10-27-11-9-26/h2-7,12H,8-11,14H2,1H3 |
| InChIKey | DQDZUAZVDVAHRF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|