C17H17N5O4 — CID 133373479
ethyl 2-nitro-5-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]benzoate (PubChem CID 133373479) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is ethyl 2-nitro-5-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]benzoate.
| Compound Name | ethyl 2-nitro-5-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 133373479 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | ethyl 2-nitro-5-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(C)c2nnc3ccccn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N5O4/c1-3-26-17(23)13-10-12(7-8-14(13)22(24)25)18-11(2)16-20-19-15-6-4-5-9-21(15)16/h4-11,18H,3H2,1-2H3 |
| InChIKey | WKIYZHBDEBRERD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|