C18H21N5O3 — CID 133430351
3-ethoxy-N-[2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-4-nitroaniline (PubChem CID 133430351) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-ethoxy-N-[2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-4-nitroaniline.
| Compound Name | 3-ethoxy-N-[2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-4-nitroaniline |
|---|---|
| PubChem CID | 133430351 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-ethoxy-N-[2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-4-nitroaniline |
| SMILES | CCOc1cc(NC(c2nnc3ccccn23)C(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N5O3/c1-4-26-15-11-13(8-9-14(15)23(24)25)19-17(12(2)3)18-21-20-16-7-5-6-10-22(16)18/h5-12,17,19H,4H2,1-3H3 |
| InChIKey | QYTUQPDUKLGGSV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|