C18H20N6O3S — CID 133373943
5,6-diethyl-3-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]pyridazine-4-carbonitrile (PubChem CID 133373943) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is 5,6-diethyl-3-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 133373943 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 5,6-diethyl-3-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(N2CCN(C(=O)c3ccc([N+](=O)[O-])s3)CC2)c(C#N)c1CC |
| InChI | InChI=1S/C18H20N6O3S/c1-3-12-13(11-19)17(21-20-14(12)4-2)22-7-9-23(10-8-22)18(25)15-5-6-16(28-15)24(26)27/h5-6H,3-4,7-10H2,1-2H3 |
| InChIKey | QCYPDWBLHFHQPG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 116.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|