C16H22N2O2S2 — CID 133374020
6-tert-butylsulfonyl-N-[(5-ethylthiophen-2-yl)methyl]pyridin-3-amine (PubChem CID 133374020) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 6-tert-butylsulfonyl-N-[(5-ethylthiophen-2-yl)methyl]pyridin-3-amine.
| Compound Name | 6-tert-butylsulfonyl-N-[(5-ethylthiophen-2-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 133374020 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 6-tert-butylsulfonyl-N-[(5-ethylthiophen-2-yl)methyl]pyridin-3-amine |
| SMILES | CCc1ccc(CNc2ccc(S(=O)(=O)C(C)(C)C)nc2)s1 |
| InChI | InChI=1S/C16H22N2O2S2/c1-5-13-7-8-14(21-13)11-17-12-6-9-15(18-10-12)22(19,20)16(2,3)4/h6-10,17H,5,11H2,1-4H3 |
| InChIKey | KSKCWCGVEQCEQW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |