C13H14ClN5 — CID 133376519
3-chloro-6-[3-imidazol-1-ylpropyl(methyl)amino]pyridine-2-carbonitrile (PubChem CID 133376519) has the molecular formula C13H14ClN5 and a molecular weight of 275.74 g/mol. Its IUPAC name is 3-chloro-6-[3-imidazol-1-ylpropyl(methyl)amino]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-6-[3-imidazol-1-ylpropyl(methyl)amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133376519 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-chloro-6-[3-imidazol-1-ylpropyl(methyl)amino]pyridine-2-carbonitrile |
| SMILES | CN(CCCn1ccnc1)c1ccc(Cl)c(C#N)n1 |
| InChI | InChI=1S/C13H14ClN5/c1-18(6-2-7-19-8-5-16-10-19)13-4-3-11(14)12(9-15)17-13/h3-5,8,10H,2,6-7H2,1H3 |
| InChIKey | AFBKIVFLEFVPKB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |